sucrose (CHEBI:17992)

ChEBI > Main

CHEBI:17992 - sucrose

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	sucrose

ChEBI ID	CHEBI:17992

Definition	A glycosyl glycoside formed by glucose and fructose units joined by an acetal oxygen bridge from hemiacetal of glucose to the hemiketal of the fructose.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:45795, CHEBI:9314, CHEBI:15128, CHEBI:26812

Supplier Information	ChemicalBook:CB0778141, eMolecules:534252, ZINC000000023894

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__750961854493632__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__750961854493632__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:17992","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__750961854493632__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"750961854493632","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__750961854493632__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 06060915243D

starting HoverWatcher_5

Time for openFile(

Marvin 06060915243D

45 46 0 0 1 0 999 V2000

-6.0899 -8.5620 2.7570 C 0 0 1 0 0 0 0 0 0 0 0 0

-7.0953 -8.2274 3.7175 O 0 0 0 0 0 0 0 0 0 0 0 0

-5.1222 -9.5780 3.3803 C 0 0 2 0 0 0 0 0 0 0 0 0

-3.8191 -9.4611 2.8081 O 0 0 0 0 0 0 0 0 0 0 0 0

-5.7912 -10.9272 3.0280 C 0 0 2 0 0 0 0 0 0 0 0 0

-6.6534 -10.7065 1.8948 O 0 0 0 0 0 0 0 0 0 0 0 0

-6.6190 -11.5206 4.1983 C 0 0 0 0 0 0 0 0 0 0 0 0

-7.1461 -12.7949 3.8527 O 0 0 0 0 0 0 0 0 0 0 0 0

-6.6798 -9.3117 1.5274 C 0 0 2 0 0 0 0 0 0 0 0 0

-5.8159 -9.1068 0.2433 C 0 0 0 0 0 0 0 0 0 0 0 0

-5.9253 -7.7753 -0.2511 O 0 0 0 0 0 0 0 0 0 0 0 0

-8.0346 -8.8288 1.3331 O 0 0 0 0 0 0 0 0 0 0 0 0

-8.9102 -9.4435 0.3563 C 0 0 2 0 0 0 0 0 0 0 0 0

-9.8730 -11.1355 1.8462 C 0 0 2 0 0 0 0 0 0 0 0 0

-11.2126 -10.3423 1.9657 C 0 0 2 0 0 0 0 0 0 0 0 0

-11.0138 -8.8334 1.6545 C 0 0 1 0 0 0 0 0 0 0 0 0

-10.2456 -8.6512 0.3165 C 0 0 1 0 0 0 0 0 0 0 0 0

-9.1848 -10.8393 0.6079 O 0 0 0 0 0 0 0 0 0 0 0 0

-10.0003 -7.2695 0.0580 O 0 0 0 0 0 0 0 0 0 0 0 0

-11.7777 -10.4921 3.2677 O 0 0 0 0 0 0 0 0 0 0 0 0

-10.0982 -12.6695 1.8979 C 0 0 0 0 0 0 0 0 0 0 0 0

-12.2812 -8.1828 1.5836 O 0 0 0 0 0 0 0 0 0 0 0 0

-8.9092 -13.3733 1.5508 O 0 0 0 0 0 0 0 0 0 0 0 0

-5.5790 -7.6363 2.4779 H 0 0 0 0 0 0 0 0 0 0 0 0

-6.6019 -7.8355 4.4691 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.0155 -9.4265 4.4582 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.2827 -10.1597 3.2380 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.0277 -11.6584 2.7490 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.9908 -11.6430 5.0823 H 0 0 0 0 0 0 0 0 0 0 0 0

-7.4480 -10.8596 4.4541 H 0 0 0 0 0 0 0 0 0 0 0 0

-7.6484 -13.0832 4.6435 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.7636 -9.3080 0.4442 H 0 0 0 0 0 0 0 0 0 0 0 0

-6.1375 -9.7944 -0.5410 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.3031 -7.7328 -1.0081 H 0 0 0 0 0 0 0 0 0 0 0 0

-8.4656 -9.3774 -0.6390 H 0 0 0 0 0 0 0 0 0 0 0 0

-9.2266 -10.8641 2.6842 H 0 0 0 0 0 0 0 0 0 0 0 0

-11.9318 -10.7460 1.2476 H 0 0 0 0 0 0 0 0 0 0 0 0

-10.4496 -8.3618 2.4670 H 0 0 0 0 0 0 0 0 0 0 0 0

-10.8568 -9.0331 -0.5084 H 0 0 0 0 0 0 0 0 0 0 0 0

-10.8890 -6.8670 -0.0416 H 0 0 0 0 0 0 0 0 0 0 0 0

-11.1161 -10.1153 3.8850 H 0 0 0 0 0 0 0 0 0 0 0 0

-10.4005 -12.9725 2.9029 H 0 0 0 0 0 0 0 0 0 0 0 0

-10.8801 -12.9625 1.1936 H 0 0 0 0 0 0 0 0 0 0 0 0

-12.7592 -8.6404 0.8609 H 0 0 0 0 0 0 0 0 0 0 0 0

-9.1734 -14.3163 1.5090 H 0 0 0 0 0 0 0 0 0 0 0 0

1 9 1 0 0 0 0

6 9 1 0 0 0 0

1 2 1 0 0 0 0

3 1 1 0 0 0 0

3 4 1 0 0 0 0

5 3 1 0 0 0 0

6 5 1 0 0 0 0

5 7 1 0 0 0 0

8 7 1 0 0 0 0

9 10 1 0 0 0 0

10 11 1 0 0 0 0

9 12 1 0 0 0 0

13 12 1 0 0 0 0

17 13 1 0 0 0 0

13 18 1 0 0 0 0

14 15 1 0 0 0 0

15 16 1 0 0 0 0

16 17 1 0 0 0 0

14 18 1 0 0 0 0

17 19 1 0 0 0 0

15 20 1 0 0 0 0

14 21 1 0 0 0 0

16 22 1 0 0 0 0

21 23 1 0 0 0 0

1 24 1 0 0 0 0

2 25 1 0 0 0 0

3 26 1 0 0 0 0

4 27 1 0 0 0 0

5 28 1 0 0 0 0

7 29 1 0 0 0 0

7 30 1 0 0 0 0

8 31 1 0 0 0 0

10 32 1 0 0 0 0

10 33 1 0 0 0 0

11 34 1 0 0 0 0

13 35 1 0 0 0 0

14 36 1 0 0 0 0

15 37 1 0 0 0 0

16 38 1 0 0 0 0

17 39 1 0 0 0 0

19 40 1 0 0 0 0

20 41 1 0 0 0 0

21 42 1 0 0 0 0

21 43 1 0 0 0 0

22 44 1 0 0 0 0

23 45 1 0 0 0 0

M END): 26 ms

reading 45 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

45 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Wikipedia	License
Sucrose, a disaccharide, is a sugar composed of glucose and fructose subunits. It is produced naturally in plants and is the main constituent of white sugar. It has the molecular formula C12H22O11. For human consumption, sucrose is extracted and refined from either sugarcane or sugar beet. Sugar mills – typically located in tropical regions near where sugarcane is grown – crush the cane and produce raw sugar which is shipped to other factories for refining into pure sucrose. Sugar beet factories are located in temperate climates where the beet is grown, and process the beets directly into refined sugar. The sugar-refining process involves washing the raw sugar crystals before dissolving them into a sugar syrup which is filtered and then passed over carbon to remove any residual colour. The sugar syrup is then concentrated by boiling under a vacuum and crystallized as the final purification process to produce crystals of pure sucrose that are clear, odorless, and sweet. Sugar is often an added ingredient in food production and recipes. About 185 million tonnes of sugar were produced worldwide in 2017.
Read full article at Wikipedia

Formula

C12H22O11

Net Charge

Average Mass

342.29650

Monoisotopic Mass

342.11621

InChI

InChI=1S/C12H22O11/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h4-11,13-20H,1-3H2/t4-,5-,6-,7-,8+,9-,10+,11-,12+/m1/s1

InChIKey

CZMRCDWAGMRECN-UGDNZRGBSA-N

SMILES

OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O

Metabolite of Species	Details
Mus musculus (NCBI:txid10090)	Source: BioModels - MODEL1507180067 See: PubMed
Chlamydomonas reinhardtii (NCBI:txid3055)	See: PubMed
Saccharomyces cerevisiae (NCBI:txid4932)	Source: yeast.sf.net See: PubMed
Escherichia coli (NCBI:txid562)	See: PubMed
Homo sapiens (NCBI:txid9606)	See: DOI

Roles Classification
Biological Role(s):	Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). osmolyte A solute used by a cell under water stress to maintain cell volume. sweetening agent Substance that sweeten food, beverages, medications, etc. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae.

Application(s):	sweetening agent Substance that sweeten food, beverages, medications, etc.

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	sucrose (CHEBI:17992) has role Escherichia coli metabolite (CHEBI:76971) sucrose (CHEBI:17992) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) sucrose (CHEBI:17992) has role algal metabolite (CHEBI:84735) sucrose (CHEBI:17992) has role human metabolite (CHEBI:77746) sucrose (CHEBI:17992) has role mouse metabolite (CHEBI:75771) sucrose (CHEBI:17992) has role osmolyte (CHEBI:25728) sucrose (CHEBI:17992) has role sweetening agent (CHEBI:50505) sucrose (CHEBI:17992) is a glycosyl glycoside (CHEBI:24407)

Incoming	β-D-fructofuranosyl 6-O-octanoyl-α-D-glucopyranoside (CHEBI:39724) has functional parent sucrose (CHEBI:17992) 1,6-kestotetraose (CHEBI:64835) has functional parent sucrose (CHEBI:17992) 6,6-kestotetraose (CHEBI:64836) has functional parent sucrose (CHEBI:17992) 6-kestotriose (CHEBI:64833) has functional parent sucrose (CHEBI:17992) agrocinopine A (CHEBI:82804) has functional parent sucrose (CHEBI:17992) agrocinopine C (CHEBI:82807) has functional parent sucrose (CHEBI:17992) stachyose (CHEBI:17164) has functional parent sucrose (CHEBI:17992) sucrose 6^F-phosphate (CHEBI:16308) has functional parent sucrose (CHEBI:17992) sucrose 6^G-phosphate (CHEBI:131603) has functional parent sucrose (CHEBI:17992) molasses (CHEBI:83163) has part sucrose (CHEBI:17992)

IUPAC Name

β-D-fructofuranosyl α-D-glucopyranoside

Synonyms	Sources
1-alpha-D-Glucopyranosyl-2-beta-D-fructofuranoside	KEGG COMPOUND
β-D-Fruf-(2↔1)-α-D-Glcp	JCBN
Cane sugar	KEGG COMPOUND
sacarosa	ChEBI
Saccharose	KEGG COMPOUND
Sacharose	ChEBI
Sucrose	KEGG COMPOUND
SUCROSE	PDBeChem
sucrose	UniProt
table sugar	ChemIDplus
White sugar	HMDB

Manual Xrefs	Databases
4610	DrugCentral
C00001151	KNApSAcK
C00089	KEGG COMPOUND
D00025	KEGG DRUG
D06533	KEGG DRUG
DB02772	DrugBank
G00370	KEGG GLYCAN
HMDB0000258	HMDB
SUC	PDBeChem
Sucrose	Wikipedia
SUCROSE	MetaCyc
View more database links

Registry Numbers	Types	Sources
1435311	Reaxys Registry Number	Reaxys
57-50-1	CAS Registry Number	ChemIDplus
57-50-1	CAS Registry Number	NIST Chemistry WebBook
90825	Reaxys Registry Number	Reaxys
97695	Gmelin Registry Number	Gmelin

Citations	Types	Sources
11021636	PubMed citation	Europe PMC
11093712	PubMed citation	Europe PMC
11111003	PubMed citation	Europe PMC
12065720	PubMed citation	Europe PMC
12706980	PubMed citation	Europe PMC
13508893	PubMed citation	Europe PMC
15291457	PubMed citation	Europe PMC
15660210	PubMed citation	Europe PMC
15792978	PubMed citation	Europe PMC
15845855	PubMed citation	Europe PMC
16228482	PubMed citation	Europe PMC
16304615	PubMed citation	Europe PMC
16313996	PubMed citation	Europe PMC
16525719	PubMed citation	Europe PMC
16660545	PubMed citation	Europe PMC
16663947	PubMed citation	Europe PMC
16665852	PubMed citation	Europe PMC
17233733	PubMed citation	Europe PMC
17439666	PubMed citation	Europe PMC
17597061	PubMed citation	Europe PMC
18625236	PubMed citation	Europe PMC
19199566	PubMed citation	Europe PMC
19726178	PubMed citation	Europe PMC
21703290	PubMed citation	Europe PMC
21972845	PubMed citation	Europe PMC
22085755	PubMed citation	Europe PMC
22311778	PubMed citation	Europe PMC
22404833	PubMed citation	Europe PMC
22751876	PubMed citation	Europe PMC

Last Modified

24 October 2024

CHEBI:17992 - sucrose

ChEBI is part of the ELIXIR infrastructure