InChI=1S/C22H21Br2NO5S2/c23- 15- 1- 5- 17(6- 2- 15) 31- 13- 14(11- 20(27) 25- 10- 9- 21(28) 29) 22(30) 19(12- 26) 32- 18- 7- 3- 16(24) 4- 8- 18/h1- 8,13,19,26H,9- 12H2,(H,25,27) (H,28,29) /b14- 13- |
ITBYEGNKUVQYNM-YPKPFQOOSA-N |
OCC(SC1=CC=C(Br)C=C1)C(=O)C(\CC(=O)NCCC(O)=O)=C/SC1=CC=C(Br)C=C1 |
|
hapten
Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals.
|
|
reagent
A substance used in a chemical reaction to detect, measure, examine, or produce other substances.
|
|
View more via ChEBI Ontology
N- [(3Z)- 5- [(4- bromophenyl)sulfanyl]- 3- {[(4- bromophenyl)sulfanyl]methylidene}- 6- hydroxy- 4- oxohexanoyl]- β- alanine
|
N- [(3Z)- 5- [(4- bromophenyl)sulfanyl]- 3- {[(4- bromophenyl)sulfanyl]methylene}- 6- hydroxy- 4- oxohexanoyl]- β- alanine
|
IUPAC
|
N- [(3Z)- 5- [(4- bromophenyl)thio]- 3- [[(4- bromophenyl)thio]methylene]- 6- hydroxy- 1,4- dioxohexyl]- β- alanine
|
ChEBI
|
34873236
|
PubMed citation
|
Europe PMC
|
|