elaidic acid (CHEBI:27997)

ChEBI > Main

CHEBI:27997 - elaidic acid

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	elaidic acid

ChEBI ID	CHEBI:27997

Definition	A 9-octadecenoic acid and the trans-isomer of oleic acid.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:10546, CHEBI:42209, CHEBI:23903

Supplier Information	ZINC000022061529

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__26415450763657__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__26415450763657__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:27997","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__26415450763657__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"26415450763657","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__26415450763657__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 02020712123D

starting HoverWatcher_5

Time for openFile(

Marvin 02020712123D

54 53 0 0 0 0 999 V2000

8.7688 -2.3657 -0.8484 C 0 0 0 0 0 0 0 0 0 0 0 0

8.1628 -1.1930 -0.2614 C 0 0 0 0 0 0 0 0 0 0 0 0

6.6515 -1.0934 -0.5778 C 0 0 0 0 0 0 0 0 0 0 0 0

6.0018 0.1640 0.0377 C 0 0 0 0 0 0 0 0 0 0 0 0

4.4922 0.2515 -0.2746 C 0 0 0 0 0 0 0 0 0 0 0 0

3.8679 1.5177 0.3457 C 0 0 0 0 0 0 0 0 0 0 0 0

2.3621 1.6409 0.0436 C 0 0 0 0 0 0 0 0 0 0 0 0

1.7816 2.9338 0.6630 C 0 0 0 0 0 0 0 0 0 0 0 0

0.3677 3.0104 0.3960 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.5469 2.4532 1.2005 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.9595 2.4425 0.9161 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.4657 0.9923 0.7424 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.9696 0.9819 0.4047 C 0 0 0 0 0 0 0 0 0 0 0 0

-4.5299 -0.4455 0.2526 C 0 0 0 0 0 0 0 0 0 0 0 0

-6.0377 -0.4196 -0.0782 C 0 0 0 0 0 0 0 0 0 0 0 0

-6.6173 -1.8413 -0.2284 C 0 0 0 0 0 0 0 0 0 0 0 0

-8.1271 -1.8336 -0.5577 C 0 0 0 0 0 0 0 0 0 0 0 0

-8.6967 -3.2573 -0.7052 C 0 0 0 0 0 0 0 0 0 0 0 0

8.4185 -3.4880 -0.5059 O 0 0 0 0 0 0 0 0 0 0 0 0

9.6354 -2.2682 -1.7064 O 0 0 0 0 0 0 0 0 0 0 0 0

8.3127 -1.2238 0.8214 H 0 0 0 0 0 0 0 0 0 0 0 0

8.6550 -0.2850 -0.6252 H 0 0 0 0 0 0 0 0 0 0 0 0

6.5068 -1.0696 -1.6626 H 0 0 0 0 0 0 0 0 0 0 0 0

6.1340 -1.9765 -0.1900 H 0 0 0 0 0 0 0 0 0 0 0 0

6.5002 1.0564 -0.3530 H 0 0 0 0 0 0 0 0 0 0 0 0

6.1428 0.1495 1.1227 H 0 0 0 0 0 0 0 0 0 0 0 0

4.3434 0.2684 -1.3584 H 0 0 0 0 0 0 0 0 0 0 0 0

3.9846 -0.6337 0.1207 H 0 0 0 0 0 0 0 0 0 0 0 0

4.3818 2.4009 -0.0453 H 0 0 0 0 0 0 0 0 0 0 0 0

4.0126 1.4933 1.4302 H 0 0 0 0 0 0 0 0 0 0 0 0

2.2089 1.6458 -1.0409 H 0 0 0 0 0 0 0 0 0 0 0 0

1.8492 0.7605 0.4469 H 0 0 0 0 0 0 0 0 0 0 0 0

1.9786 2.9556 1.7401 H 0 0 0 0 0 0 0 0 0 0 0 0

2.2742 3.8103 0.2344 H 0 0 0 0 0 0 0 0 0 0 0 0

0.0846 3.4590 -0.4460 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.2525 1.9959 2.0356 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.2000 3.0107 0.0112 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.4751 2.9270 1.7483 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.2988 0.4244 1.6639 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.9143 0.4922 -0.0616 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.1299 1.5294 -0.5293 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.5165 1.4995 1.1987 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.9882 -0.9639 -0.5445 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.3688 -0.9974 1.1836 H 0 0 0 0 0 0 0 0 0 0 0 0

-6.1926 0.1354 -1.0085 H 0 0 0 0 0 0 0 0 0 0 0 0

-6.5717 0.1066 0.7190 H 0 0 0 0 0 0 0 0 0 0 0 0

-6.4531 -2.3900 0.7038 H 0 0 0 0 0 0 0 0 0 0 0 0

-6.0756 -2.3613 -1.0242 H 0 0 0 0 0 0 0 0 0 0 0 0

-8.6712 -1.3142 0.2363 H 0 0 0 0 0 0 0 0 0 0 0 0

-8.2946 -1.2858 -1.4894 H 0 0 0 0 0 0 0 0 0 0 0 0

-9.7612 -3.2093 -0.9366 H 0 0 0 0 0 0 0 0 0 0 0 0

-8.1883 -3.7895 -1.5118 H 0 0 0 0 0 0 0 0 0 0 0 0

-8.5668 -3.8178 0.2228 H 0 0 0 0 0 0 0 0 0 0 0 0

9.9898 -2.9861 -2.0705 H 0 0 0 0 0 0 0 0 0 0 0 0

2 1 1 0 0 0 0

20 1 1 0 0 0 0

19 1 2 0 0 0 0

3 2 1 0 0 0 0

4 3 1 0 0 0 0

5 4 1 0 0 0 0

6 5 1 0 0 0 0

7 6 1 0 0 0 0

8 7 1 0 0 0 0

9 8 1 0 0 0 0

10 9 2 0 0 0 0

11 10 1 0 0 0 0

12 11 1 0 0 0 0

13 12 1 0 0 0 0

14 13 1 0 0 0 0

15 14 1 0 0 0 0

16 15 1 0 0 0 0

17 16 1 0 0 0 0

18 17 1 0 0 0 0

2 21 1 0 0 0 0

2 22 1 0 0 0 0

3 23 1 0 0 0 0

3 24 1 0 0 0 0

4 25 1 0 0 0 0

4 26 1 0 0 0 0

5 27 1 0 0 0 0

5 28 1 0 0 0 0

6 29 1 0 0 0 0

6 30 1 0 0 0 0

7 31 1 0 0 0 0

7 32 1 0 0 0 0

8 33 1 0 0 0 0

8 34 1 0 0 0 0

9 35 1 0 0 0 0

10 36 1 0 0 0 0

11 37 1 0 0 0 0

11 38 1 0 0 0 0

12 39 1 0 0 0 0

12 40 1 0 0 0 0

13 41 1 0 0 0 0

13 42 1 0 0 0 0

14 43 1 0 0 0 0

14 44 1 0 0 0 0

15 45 1 0 0 0 0

15 46 1 0 0 0 0

16 47 1 0 0 0 0

16 48 1 0 0 0 0

17 49 1 0 0 0 0

17 50 1 0 0 0 0

18 51 1 0 0 0 0

18 52 1 0 0 0 0

18 53 1 0 0 0 0

20 54 1 0 0 0 0

M END): 24 ms

reading 54 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

54 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Wikipedia	License
[object Object]
Read full article at Wikipedia

Formula

C18H34O2

Net Charge

Average Mass

282.46140

Monoisotopic Mass

282.25588

InChI

InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9+

InChIKey

ZQPPMHVWECSIRJ-MDZDMXLPSA-N

SMILES

CCCCCCCC\C=C\CCCCCCCC(O)=O

Roles Classification
Chemical Role(s):	Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Bronsted base). (via oxoacid )

Biological Role(s):	food component A physiological role played by any substance that is distributed in foodstuffs. It includes materials derived from plants or animals, such as vitamins or minerals, as well as environmental contaminants. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. (via octadec-9-enoic acid )

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	elaidic acid (CHEBI:27997) has parent hydride trans-octadec-9-ene (CHEBI:37607) elaidic acid (CHEBI:27997) has role food component (CHEBI:78295) elaidic acid (CHEBI:27997) is a octadec-9-enoic acid (CHEBI:36021) elaidic acid (CHEBI:27997) is conjugate acid of elaidate (CHEBI:30825) elaidic acid (CHEBI:27997) is conjugate acid of Octadec-9-enoic acid anion (CHEBI:231086)

Incoming	(9E)-10-nitrooctadecenoic acid (CHEBI:86285) has functional parent elaidic acid (CHEBI:27997) (9E)-12-(phosphonooxy)octadecenoic acid (CHEBI:85136) has functional parent elaidic acid (CHEBI:27997) (9E)-12-hydroxyoctadec-9-enoic acid (CHEBI:85641) has functional parent elaidic acid (CHEBI:27997) (9E)-9-nitrooctadecenoic acid (CHEBI:86329) has functional parent elaidic acid (CHEBI:27997) (9E)-octadec-9-enoylcarnitine (CHEBI:86038) has functional parent elaidic acid (CHEBI:27997) 1,2-di-(9E-octadecenoyl)-sn-glycero-3-phospho-(1'-sn-glycerol) (CHEBI:84525) has functional parent elaidic acid (CHEBI:27997) 1-[(9E)-octadecenoyl]glycerol (CHEBI:131342) has functional parent elaidic acid (CHEBI:27997) 2-[(9E)-9-octadecenoyl]glycerol (CHEBI:131380) has functional parent elaidic acid (CHEBI:27997) cholesteryl elaidate (CHEBI:46902) has functional parent elaidic acid (CHEBI:27997) cystodytin H (CHEBI:65714) has functional parent elaidic acid (CHEBI:27997) cystodytin I (CHEBI:65715) has functional parent elaidic acid (CHEBI:27997) hexadecyl elaidate (CHEBI:84072) has functional parent elaidic acid (CHEBI:27997) ricinelaidic acid (CHEBI:45478) has functional parent elaidic acid (CHEBI:27997) trielaidin (CHEBI:53759) has functional parent elaidic acid (CHEBI:27997) elaidate (CHEBI:30825) is conjugate base of elaidic acid (CHEBI:27997) Octadec-9-enoic acid anion (CHEBI:231086) is conjugate base of elaidic acid (CHEBI:27997) elaidoyl group (CHEBI:23904) is substituent group from elaidic acid (CHEBI:27997)

IUPAC Name

(9E)-octadec-9-enoic acid

Synonyms	Sources
(9E)-Octadecenoic acid	KEGG COMPOUND
(E)-Oleic acid	KEGG COMPOUND
9-OCTADECENOIC ACID	PDBeChem
9-Octadecenoic acid, (E)-	KEGG COMPOUND
9-trans-Octadecenoic acid	KEGG COMPOUND
Acide elaidique	KEGG COMPOUND
D9-trans-Octadecenoic acid	KEGG COMPOUND
Elaidic acid	KEGG COMPOUND
Elaidinsaure	KEGG COMPOUND
Elaidinsäure	ChEBI
trans-9-Octadecenoic acid	KEGG COMPOUND
trans-D9-Octadecenoic acid	KEGG COMPOUND
trans-Δ⁹-octadecenoic acid	ChemIDplus
trans-Elaidic acid	KEGG COMPOUND
trans-Oleic acid	KEGG COMPOUND

Manual Xrefs	Databases
C01712	KEGG COMPOUND
ELA	PDBeChem
Elaidic_acid	Wikipedia
HMDB0000573	HMDB
LMFA01030073	LIPID MAPS
View more database links

Registry Numbers	Types	Sources
112-79-8	CAS Registry Number	KEGG COMPOUND
112-79-8	CAS Registry Number	NIST Chemistry WebBook
112-79-8	CAS Registry Number	ChemIDplus
171874	Gmelin Registry Number	Gmelin
1726543	Reaxys Registry Number	Reaxys

Citations	Types	Sources
10342226	PubMed citation	Europe PMC
23601386	PubMed citation	Europe PMC
24800387	PubMed citation	Europe PMC
8018112	PubMed citation	Europe PMC
881948	PubMed citation	Europe PMC

Last Modified

04 April 2018

General Comment
2011-03-29	Elaidic acid is a major trans-fat in hydrogenated vegetable oils. Also occurring in small amounts in caprine and bovine milk, it is known to have atherogenic effects.

CHEBI:27997 - elaidic acid

ChEBI is part of the ELIXIR infrastructure