decanoic acid (CHEBI:30813)

ChEBI > Main

CHEBI:30813 - decanoic acid

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	decanoic acid

ChEBI ID	CHEBI:30813

Definition	A C₁₀, straight-chain saturated fatty acid.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:41906, CHEBI:23572, CHEBI:4347

Supplier Information	ChemicalBook:CB9154454, eMolecules:494155, ZINC000001580987

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__873030105104614__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__873030105104614__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:30813","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__873030105104614__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"873030105104614","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__873030105104614__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 12161110413D

starting HoverWatcher_5

Time for openFile(

Marvin 12161110413D

32 31 0 0 0 0 999 V2000

2.0947 4.3625 2.7428 C 0 0 0 0 0 0 0 0 0 0 0 0

2.6485 5.6675 2.9043 O 0 0 0 0 0 0 0 0 0 0 0 0

1.0674 4.3802 1.5991 C 0 0 0 0 0 0 0 0 0 0 0 0

0.4766 2.9721 1.4271 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.5149 2.9630 0.2517 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.0670 1.5395 0.0718 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.0201 1.4962 -1.1368 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.5418 0.0611 -1.3444 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.3746 -0.8828 -1.6895 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.9001 -2.3179 -1.8565 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.7234 -3.2584 -2.1667 C 0 0 0 0 0 0 0 0 0 0 0 0

3.1366 3.4386 2.4307 O 0 0 0 0 0 0 0 0 0 0 0 0

2.5959 6.1344 3.8064 H 0 0 0 0 0 0 0 0 0 0 0 0

1.5691 4.6923 0.6517 H 0 0 0 0 0 0 0 0 0 0 0 0

0.2498 5.1004 1.8428 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.0554 2.6768 2.3633 H 0 0 0 0 0 0 0 0 0 0 0 0

1.3010 2.2471 1.2224 H 0 0 0 0 0 0 0 0 0 0 0 0

0.0084 3.2817 -0.6817 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.3558 3.6657 0.4662 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.6224 1.2393 0.9928 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.2192 0.8333 -0.0991 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.4717 1.8267 -2.0516 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.8827 2.1807 -0.9516 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.2812 0.0545 -2.1809 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.0362 -0.2912 -0.4072 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.6208 -0.8581 -0.8662 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.8969 -0.5503 -2.6424 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.6347 -2.3502 -2.6968 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.3992 -2.6441 -0.9124 H 0 0 0 0 0 0 0 0 0 0 0 0

0.1842 -2.6527 -2.4039 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.9817 -3.9005 -3.0430 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.5187 -3.9033 -1.2783 H 0 0 0 0 0 0 0 0 0 0 0 0

1 12 2 0 0 0 0

1 3 1 0 0 0 0

1 2 1 0 0 0 0

13 2 1 0 0 0 0

3 4 1 0 0 0 0

14 3 1 0 0 0 0

15 3 1 0 0 0 0

4 5 1 0 0 0 0

16 4 1 0 0 0 0

17 4 1 0 0 0 0

5 6 1 0 0 0 0

18 5 1 0 0 0 0

19 5 1 0 0 0 0

6 7 1 0 0 0 0

20 6 1 0 0 0 0

21 6 1 0 0 0 0

7 8 1 0 0 0 0

22 7 1 0 0 0 0

23 7 1 0 0 0 0

8 9 1 0 0 0 0

24 8 1 0 0 0 0

25 8 1 0 0 0 0

9 10 1 0 0 0 0

26 9 1 0 0 0 0

27 9 1 0 0 0 0

10 11 1 0 0 0 0

28 10 1 0 0 0 0

29 10 1 0 0 0 0

30 11 1 0 0 0 0

31 11 1 0 0 0 0

32 11 1 0 0 0 0

M END): 20 ms

reading 32 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

32 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Molfile

Formula

C10H20O2

Net Charge

Average Mass

172.265

Monoisotopic Mass

172.14633

InChI

InChI=1S/C10H20O2/c1-2-3-4-5-6-7-8-9-10(11)12/h2-9H2,1H3,(H,11,12)

InChIKey

GHVNFZFCNZKVNT-UHFFFAOYSA-N

SMILES

C(CCCCCC)CCC(=O)O

Metabolite of Species	Details
Cistus creticus (NCBI:txid191224)	See: DOI
Chlamydomonas reinhardtii (NCBI:txid3055)	See: PubMed
Homo sapiens (NCBI:txid9606)	See: PubMed

Roles Classification
Chemical Role(s):	Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Bronsted base). (via oxoacid )

Biological Role(s):	algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms.

Application(s):	anti-inflammatory agent Any compound that has anti-inflammatory effects.

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	decanoic acid (CHEBI:30813) has parent hydride decane (CHEBI:41808) decanoic acid (CHEBI:30813) has role algal metabolite (CHEBI:84735) decanoic acid (CHEBI:30813) has role anti-inflammatory agent (CHEBI:67079) decanoic acid (CHEBI:30813) has role antibacterial agent (CHEBI:33282) decanoic acid (CHEBI:30813) has role human metabolite (CHEBI:77746) decanoic acid (CHEBI:30813) has role plant metabolite (CHEBI:76924) decanoic acid (CHEBI:30813) has role volatile oil component (CHEBI:27311) decanoic acid (CHEBI:30813) is a medium-chain fatty acid (CHEBI:59554) decanoic acid (CHEBI:30813) is a straight-chain saturated fatty acid (CHEBI:39418) decanoic acid (CHEBI:30813) is conjugate acid of decanoate (CHEBI:27689)

Incoming	(3S,4S)-3-hydroxy-4-methyldecanoic acid (CHEBI:71005) has functional parent decanoic acid (CHEBI:30813) (9R)-9-hydroxydecanoic acid (CHEBI:78951) has functional parent decanoic acid (CHEBI:30813) (R)-3-hydroxydecanoyl-CoA (CHEBI:74405) has functional parent decanoic acid (CHEBI:30813) (S)-3-hydroxydecanoic acid (CHEBI:37371) has functional parent decanoic acid (CHEBI:30813) (S)-3-hydroxydecanoyl-CoA (CHEBI:28325) has functional parent decanoic acid (CHEBI:30813) 1-O-(α-D-galactosyl)-N-decanoylphytosphingosine (CHEBI:84160) has functional parent decanoic acid (CHEBI:30813) 10-hydroxycapric acid (CHEBI:17409) has functional parent decanoic acid (CHEBI:30813) 10-oxocapric acid (CHEBI:17130) has functional parent decanoic acid (CHEBI:30813) 2-hydroxydecanoic acid (CHEBI:133172) has functional parent decanoic acid (CHEBI:30813) 2-oxodecanoic acid (CHEBI:34301) has functional parent decanoic acid (CHEBI:30813) 3-hydroxydecanoic acid (CHEBI:132983) has functional parent decanoic acid (CHEBI:30813) 3-oxodecanoic acid (CHEBI:37157) has functional parent decanoic acid (CHEBI:30813) N-(decanoyl)ethanolamine (CHEBI:85301) has functional parent decanoic acid (CHEBI:30813) N-capryl-1-palmitoyl-2-linoleoyl-sn-glycero-3-phosphoethanolamine (CHEBI:85796) has functional parent decanoic acid (CHEBI:30813) N-decanoyl-(2S)-hydroxyglycine (CHEBI:142744) has functional parent decanoic acid (CHEBI:30813) N-decanoylglycine (CHEBI:74430) has functional parent decanoic acid (CHEBI:30813) N-decanoylsphingosine (CHEBI:72955) has functional parent decanoic acid (CHEBI:30813) N-decanoylsphingosine 1-phosphate (CHEBI:73147) has functional parent decanoic acid (CHEBI:30813) S-decanoyl-4ʼ-phosphopantetheine (CHEBI:132313) has functional parent decanoic acid (CHEBI:30813) caprate phytyl ester (CHEBI:177028) has functional parent decanoic acid (CHEBI:30813) decanamide (CHEBI:38833) has functional parent decanoic acid (CHEBI:30813) decanoate ester (CHEBI:87658) has functional parent decanoic acid (CHEBI:30813) decanoyl-CoA (CHEBI:28493) has functional parent decanoic acid (CHEBI:30813) decanoylcholine (CHEBI:74107) has functional parent decanoic acid (CHEBI:30813) perfluorodecanoic acid (CHEBI:35546) has functional parent decanoic acid (CHEBI:30813) pescaprein XXIV (CHEBI:67854) has functional parent decanoic acid (CHEBI:30813) pescaprein XXVI (CHEBI:67856) has functional parent decanoic acid (CHEBI:30813) propyl decanoate (CHEBI:86973) has functional parent decanoic acid (CHEBI:30813) decanoate (CHEBI:27689) is conjugate base of decanoic acid (CHEBI:30813) decanoyl group (CHEBI:23574) is substituent group from decanoic acid (CHEBI:30813)

IUPAC Name

decanoic acid

Synonyms	Sources
1-nonanecarboxylic acid	ChemIDplus
10:0	ChEBI
C10:0	ChEBI
capric acid	ChEBI
caprinic acid	NIST Chemistry WebBook
CH₃‒[CH₂]₈‒COOH	IUPAC
Decanoate	KEGG COMPOUND
Decanoic acid	KEGG COMPOUND
DECANOIC ACID	PDBeChem
decoic acid	NIST Chemistry WebBook
Decylic acid	KEGG COMPOUND
Dekansäure	ChEBI
Kaprinsäure	ChEBI
n-Capric acid	KEGG COMPOUND
n-decanoic acid	NIST Chemistry WebBook
n-decoic acid	ChemIDplus
n-decylic acid	ChemIDplus

Manual Xrefs	Databases
C00001213	KNApSAcK
C01571	KEGG COMPOUND
CPD-3617	MetaCyc
DB03600	DrugBank
DKA	PDBeChem
ECMDB21204	ECMDB
HMDB0000511	HMDB
LMFA01010010	LIPID MAPS
YMDB00677	YMDB
View more database links

Registry Numbers	Types	Sources
1754556	Beilstein Registry Number	Beilstein
334-48-5	CAS Registry Number	KEGG COMPOUND
334-48-5	CAS Registry Number	NIST Chemistry WebBook
334-48-5	CAS Registry Number	ChemIDplus
69184	Gmelin Registry Number	Gmelin

Citations	Types	Sources
19168249	PubMed citation	Europe PMC
20661498	PubMed citation	Europe PMC
24284257	PubMed citation	Europe PMC
24357269	PubMed citation	Europe PMC

Last Modified

10 August 2021

General Comment
2011-03-29	Capric acid, together with caproic (C6) and caprylic (C8) acids, constitutes 15% of goat milk fat (L. caper = goat). It has antimicrobial activity, and can be used in the production of iron oxide nanoparticles.

CHEBI:30813 - decanoic acid

ChEBI is part of the ELIXIR infrastructure