metsulfuron methyl (CHEBI:39678)

ChEBI > Main

CHEBI:39678 - metsulfuron methyl

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	metsulfuron methyl

ChEBI ID	CHEBI:39678

Definition	A N-sulfonylurea in which the sulfonyl group is attached to a 2-(methoxycarbonyl)phenyl group while a (4-methoxy-6-methyl-1,3,5-triazin-2-yl group replaces one of the amino hydrogens of the remaining urea group.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:6910

Supplier Information	ChemicalBook:CB9251528, eMolecules:511356, ZINC000001532069

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__864627339190544__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__864627339190544__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:39678","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__864627339190544__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"864627339190544","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__864627339190544__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Mrv0541 02181416033D

starting HoverWatcher_5

Time for openFile(

Mrv0541 02181416033D

41 42 0 0 0 0 999 V2000

-2.5880 2.6560 -1.8250 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.0450 1.6810 -2.6940 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.1740 0.3770 -2.2660 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.8400 0.0410 -0.9520 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.3840 1.0300 -0.0790 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.2550 2.3300 -0.5220 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.9610 0.6170 1.5810 S 0 0 1 0 0 0 0 0 0 0 0 0

-0.7550 -0.5160 1.5170 N 0 0 0 0 0 0 0 0 0 0 0 0

0.4240 -0.2140 0.9370 C 0 0 0 0 0 0 0 0 0 0 0 0

1.3690 -1.1640 0.7980 N 0 0 0 0 0 0 0 0 0 0 0 0

2.6200 -0.8290 0.3060 C 0 0 0 0 0 0 0 0 0 0 0 0

3.5190 -1.7810 0.0690 N 0 0 0 0 0 0 0 0 0 0 0 0

4.7120 -1.4620 -0.4010 C 0 0 0 0 0 0 0 0 0 0 0 0

5.0170 -0.1970 -0.6360 N 0 0 0 0 0 0 0 0 0 0 0 0

4.1230 0.7580 -0.4010 C 0 0 0 0 0 0 0 0 0 0 0 0

2.9220 0.4410 0.0660 N 0 0 0 0 0 0 0 0 0 0 0 0

-1.3650 1.7840 2.1290 O 0 0 0 0 0 0 0 0 0 0 0 0

-3.0940 -0.0550 2.1120 O 0 0 0 0 0 0 0 0 0 0 0 0

0.6340 0.9160 0.5410 O 0 0 0 0 0 0 0 0 0 0 0 0

-2.9760 -1.3550 -0.4860 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.3950 -2.3110 -1.3370 O 0 0 0 0 0 0 0 0 0 0 0 0

-3.6340 -3.6590 -0.8530 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.7090 -1.6400 0.6640 O 0 0 0 0 0 0 0 0 0 0 0 0

4.4360 2.0520 -0.6420 O 0 0 0 0 0 0 0 0 0 0 0 0

3.3340 2.8370 -0.1820 C 0 0 0 0 0 0 0 0 0 0 0 0

5.7280 -2.5420 -0.6690 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.6940 -4.0960 -0.5160 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.3380 -3.6270 -0.0210 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.0500 -4.2660 -1.6570 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.5310 -0.3830 -2.9450 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.3020 1.9430 -3.7100 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.4890 3.6770 -2.1660 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.8980 3.0960 0.1500 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.8970 -1.3980 1.8960 H 0 0 0 0 0 0 0 0 0 0 0 0

1.1740 -2.0820 1.0410 H 0 0 0 0 0 0 0 0 0 0 0 0

5.6200 -2.8960 -1.6940 H 0 0 0 0 0 0 0 0 0 0 0 0

6.7320 -2.1400 -0.5270 H 0 0 0 0 0 0 0 0 0 0 0 0

5.5680 -3.3710 0.0200 H 0 0 0 0 0 0 0 0 0 0 0 0

2.4180 2.4960 -0.6670 H 0 0 0 0 0 0 0 0 0 0 0 0

3.2350 2.7270 0.8980 H 0 0 0 0 0 0 0 0 0 0 0 0

3.5060 3.8850 -0.4270 H 0 0 0 0 0 0 0 0 0 0 0 0

1 2 4 0 0 0 0

1 6 4 0 0 0 0

1 32 1 0 0 0 0

2 3 4 0 0 0 0

2 31 1 0 0 0 0

3 4 4 0 0 0 0

3 30 1 0 0 0 0

4 5 4 0 0 0 0

4 20 1 0 0 0 0

5 6 4 0 0 0 0

5 7 1 0 0 0 0

6 33 1 0 0 0 0

7 8 1 0 0 0 0

7 17 2 0 0 0 0

7 18 2 0 0 0 0

8 9 1 0 0 0 0

8 34 1 0 0 0 0

9 10 1 0 0 0 0

9 19 2 0 0 0 0

10 11 1 0 0 0 0

10 35 1 0 0 0 0

11 12 4 0 0 0 0

11 16 4 0 0 0 0

12 13 4 0 0 0 0

13 14 4 0 0 0 0

13 26 1 0 0 0 0

14 15 4 0 0 0 0

15 16 4 0 0 0 0

15 24 1 0 0 0 0

20 21 1 0 0 0 0

20 23 2 0 0 0 0

21 22 1 0 0 0 0

22 27 1 0 0 0 0

22 28 1 0 0 0 0

22 29 1 0 0 0 0

24 25 1 0 0 0 0

25 39 1 0 0 0 0

25 40 1 0 0 0 0

25 41 1 0 0 0 0

26 36 1 0 0 0 0

26 37 1 0 0 0 0

26 38 1 0 0 0 0

M END): 16 ms

reading 41 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

41 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Wikipedia	License
Metsulfuron-methyl is an organic compound classified as a sulfonylurea herbicide, which kills broadleaf weeds and some annual grasses. It is a systemic compound with foliar and soil activity, that inhibits cell division in shoots and roots. It has residual activity in soils, allowing it to be used infrequently but requiring up to 22 months before planting certain crops (sunflowers, flax, corn, or safflower). It has very low toxicity to mammals, birds, fish, and insects but is a moderate eye irritant.
Read full article at Wikipedia

Formula

C14H15N5O6S

Net Charge

Average Mass

381.36400

Monoisotopic Mass

381.07430

InChI

InChI=1S/C14H15N5O6S/c1-8-15-12(18-14(16-8)25-3)17-13(21)19-26(22,23)10-7-5-4-6-9(10)11(20)24-2/h4-7H,1-3H3,(H2,15,16,17,18,19,21)

InChIKey

RSMUVYRMZCOLBH-UHFFFAOYSA-N

SMILES

COC(=O)c1ccccc1S(=O)(=O)NC(=O)Nc1nc(C)nc(OC)n1

Roles Classification
Chemical Role(s):	environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects.

Biological Role(s):	xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means.

Application(s):	herbicide A substance used to destroy plant pests.

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	metsulfuron methyl (CHEBI:39678) has role environmental contaminant (CHEBI:78298) metsulfuron methyl (CHEBI:39678) has role herbicide (CHEBI:24527) metsulfuron methyl (CHEBI:39678) has role xenobiotic (CHEBI:35703) metsulfuron methyl (CHEBI:39678) is a N-sulfonylurea (CHEBI:76983) metsulfuron methyl (CHEBI:39678) is a benzoate ester (CHEBI:36054) metsulfuron methyl (CHEBI:39678) is a methoxy-1,3,5-triazine (CHEBI:38177)

IUPAC Name

methyl 2-{[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoyl]sulfamoyl}benzoate

Synonyms	Sources
Metsulfuron methyl	KEGG COMPOUND
Metsulfuron methyl ester	ChemIDplus
metsulfuron-methyl	ChEBI

Manual Xrefs	Databases
1MM	PDBeChem
470	PPDB
C10946	KEGG COMPOUND
metsulfuron-methyl	Alan Wood's Pesticides
Metsulfuron-methyl	Wikipedia
View more database links

Registry Numbers	Types	Sources
587472	Reaxys Registry Number	Reaxys
74223-64-6	CAS Registry Number	KEGG COMPOUND
74223-64-6	CAS Registry Number	ChemIDplus

Citations

Singh N, Bala Singh S, Raunaq, Das TK (2013)
Effect of fly ash on persistence, mobility and bio-efficacy of metribuzin and metsulfuron-methyl in crop fields.
Ecotoxicology and environmental safety 97, 236-241 [PubMed:23972318]
[show Abstract]

da Silva AC, Deda DK, da Róz AL, Prado RA, Carvalho CC, Viviani V, Leite FL (2013)
Nanobiosensors based on chemically modified AFM probes: a useful tool for metsulfuron-methyl detection.
Sensors (Basel, Switzerland) 13, 1477-1489 [PubMed:23348034]
[show Abstract]

Pretto A, Loro VL, Menezes C, Moraes BS, Reimche GB, Zanella R, de Ávila LA (2011)
Commercial formulation containing quinclorac and metsulfuron-methyl herbicides inhibit acetylcholinesterase and induce biochemical alterations in tissues of Leporinus obtusidens.
Ecotoxicology and environmental safety 74, 336-341 [PubMed:21036398]
[show Abstract]

Last Modified

14 March 2024

General Comment
2014-10-29	Stravs M, Schymanski E, Singer H, Department of Environmental Chemistry, Eawag

CHEBI:39678 - metsulfuron methyl

ChEBI is part of the ELIXIR infrastructure