8-anilinonaphthalene-1-sulfonic acid (CHEBI:39708)

ChEBI > Main

CHEBI:39708 - 8-anilinonaphthalene-1-sulfonic acid

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	8-anilinonaphthalene-1-sulfonic acid

ChEBI ID	CHEBI:39708

Definition	A naphthalenesulfonic acid that is naphthalene-1-sulfonic acid substituted by a phenylamino group at position 8.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:39697, CHEBI:2309

Supplier Information	ChemicalBook:CB8289935, eMolecules:481490, ZINC000001532216

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__484514494845891__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__484514494845891__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:39708","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__484514494845891__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"484514494845891","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__484514494845891__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 05020714403D

starting HoverWatcher_5

Time for openFile(

Marvin 05020714403D

34 36 0 0 0 0 999 V2000

-0.8500 -2.5529 -0.7271 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.3730 -3.8496 -0.4389 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.9462 -0.0590 -1.3091 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.7646 -1.1911 -1.3605 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.2258 -2.4338 -1.0217 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.6022 -0.1260 -0.8685 C 0 0 0 0 0 0 0 0 0 0 0 0

0.0235 -1.4097 -0.7171 C 0 0 0 0 0 0 0 0 0 0 0 0

0.9813 -4.0591 -0.1712 C 0 0 0 0 0 0 0 0 0 0 0 0

1.8670 -2.9787 -0.2254 C 0 0 0 0 0 0 0 0 0 0 0 0

1.4258 -1.6684 -0.5307 C 0 0 0 0 0 0 0 0 0 0 0 0

4.1351 -1.2725 -1.0798 O 0 0 0 0 0 0 0 0 0 0 0 0

2.6239 0.5630 -1.8035 O 0 0 0 0 0 0 0 0 0 0 0 0

0.0472 0.9868 -0.5123 N 0 0 0 0 0 0 0 0 0 0 0 0

-0.3197 2.0333 0.2373 C 0 0 0 0 0 0 0 0 0 0 0 0

0.3462 3.3464 2.2149 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.9084 3.9762 2.2351 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.8379 3.7092 1.2166 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.5342 2.7643 0.2189 C 0 0 0 0 0 0 0 0 0 0 0 0

0.6366 2.4069 1.2107 C 0 0 0 0 0 0 0 0 0 0 0 0

2.7750 -0.5503 -0.6773 S 0 0 1 0 0 0 0 0 0 0 0 0

3.1059 0.1006 0.7335 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.9939 -4.6642 -0.4159 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.3808 0.8111 -1.6005 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.7492 -1.1096 -1.6274 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.8580 -3.2399 -1.0145 H 0 0 0 0 0 0 0 0 0 0 0 0

1.3226 -4.9977 0.0496 H 0 0 0 0 0 0 0 0 0 0 0 0

2.8481 -3.2015 -0.0382 H 0 0 0 0 0 0 0 0 0 0 0 0

0.9633 0.9479 -0.6324 H 0 0 0 0 0 0 0 0 0 0 0 0

1.0415 3.5601 2.9334 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.1399 4.6316 2.9839 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.7362 4.1977 1.2053 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.2333 2.6458 -0.5077 H 0 0 0 0 0 0 0 0 0 0 0 0

1.5639 1.9838 1.2334 H 0 0 0 0 0 0 0 0 0 0 0 0

3.7465 0.6996 0.8071 H 0 0 0 0 0 0 0 0 0 0 0 0

1 2 4 0 0 0 0

3 4 4 0 0 0 0

5 1 4 0 0 0 0

4 5 4 0 0 0 0

6 3 4 0 0 0 0

6 13 1 0 0 0 0

7 1 4 0 0 0 0

7 6 4 0 0 0 0

2 8 4 0 0 0 0

8 9 4 0 0 0 0

10 7 4 0 0 0 0

9 10 4 0 0 0 0

10 20 1 0 0 0 0

20 11 2 0 0 0 0

20 12 2 0 0 0 0

13 14 1 0 0 0 0

18 14 4 0 0 0 0

14 19 4 0 0 0 0

15 16 4 0 0 0 0

15 19 4 0 0 0 0

16 17 4 0 0 0 0

17 18 4 0 0 0 0

20 21 1 0 0 0 0

2 22 1 0 0 0 0

3 23 1 0 0 0 0

4 24 1 0 0 0 0

5 25 1 0 0 0 0

8 26 1 0 0 0 0

9 27 1 0 0 0 0

13 28 1 0 0 0 0

15 29 1 0 0 0 0

16 30 1 0 0 0 0

17 31 1 0 0 0 0

18 32 1 0 0 0 0

19 33 1 0 0 0 0

21 34 1 0 0 0 0

M END): 25 ms

reading 34 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

34 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Wikipedia	License
8-Anilinonaphthalene-1-sulfonic acid (ANS), also called 1-anilino-8-naphthalenesulfonate, is an organic compound containing both a sulfonic acid and an amine group. This compound is used as a fluorescent molecular probe. For example, ANS can be used to study conformational changes induced by ligand binding in proteins, as ANS's fluorescent properties will change as it binds to hydrophobic regions on the protein surface. Comparison of the fluorescence in the presence and absence of a particular ligand can thus give information about how the binding of the ligand changes the surface of the protein. Its permeability to mitochondrial membranes makes it particularly useful.
Read full article at Wikipedia

Formula

C16H13NO3S

Net Charge

Average Mass

299.34536

Monoisotopic Mass

299.06161

InChI

InChI=1S/C16H13NO3S/c18-21(19,20)15-11-5-7-12-6-4-10-14(16(12)15)17-13-8-2-1-3-9-13/h1-11,17H,(H,18,19,20)

InChIKey

FWEOQOXTVHGIFQ-UHFFFAOYSA-N

SMILES

OS(=O)(=O)c1cccc2cccc(Nc3ccccc3)c12

Roles Classification
Chemical Role(s):	Bronsted base A molecular entity capable of accepting a hydron from a donor (Bronsted acid). (via organic amino compound )

Application(s):	fluorescent probe A role played by a fluorescent molecular entity used to study the microscopic environment by fluorescence spectroscopy.

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	8-anilinonaphthalene-1-sulfonic acid (CHEBI:39708) has role fluorescent probe (CHEBI:39442) 8-anilinonaphthalene-1-sulfonic acid (CHEBI:39708) is a aminonaphthalene (CHEBI:38034) 8-anilinonaphthalene-1-sulfonic acid (CHEBI:39708) is a naphthalenesulfonic acid (CHEBI:36336)

IUPAC Name

8-anilinonaphthalene-1-sulfonic acid

Synonyms	Sources
1-(phenylamino)-8-naphthalenesulfonic acid	ChemIDplus
1-ANILINO-8-NAPHTHALENE SULFONATE	PDBeChem
1-Anilino-8-naphthalenesulfonate	KEGG COMPOUND
1-anilino-8-naphthalenesulfonic acid	ChemIDplus
8-Anilino-1-naphthalene sulfonic acid	KEGG COMPOUND
8-anilinonaphthalene-1-sulphonic acid	ChemIDplus
ANS	KEGG COMPOUND

Manual Xrefs	Databases
2AN	PDBeChem
8-Anilinonaphthalene-1-sulfonic_acid	Wikipedia
C11326	KEGG COMPOUND
DB04474	DrugBank
View more database links

Registry Numbers	Types	Sources
1843887	Beilstein Registry Number	Beilstein
1843887	Reaxys Registry Number	Reaxys
82-76-8	CAS Registry Number	ChemIDplus

Citation

Kanjilal S, Taulier N, Le Huérou JY, Gindre M, Urbach W, Waks M (2003)
Ultrasonic studies of alcohol-induced transconformation in beta-lactoglobulin: the intermediate state.
Biophysical journal 85, 3928-3934 [PubMed:14645081]
[show Abstract]

Last Modified

23 October 2015

CHEBI:39708 - 8-anilinonaphthalene-1-sulfonic acid

ChEBI is part of the ELIXIR infrastructure