sebacic acid (CHEBI:41865)

ChEBI > Main

CHEBI:41865 - sebacic acid

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	sebacic acid

ChEBI ID	CHEBI:41865

Definition	An α,ω-dicarboxylic acid that is the 1,8-dicarboxy derivative of octane.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:41860, CHEBI:9071

Supplier Information	ChemicalBook:CB0329394, ChemicalBook:CB8109750, eMolecules:494560, ZINC000001531045

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__9763684591834809__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__9763684591834809__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:41865","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__9763684591834809__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"9763684591834809","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__9763684591834809__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 01070800423D

starting HoverWatcher_5

Time for openFile(

Marvin 01070800423D

32 31 0 0 0 0 999 V2000

-4.0459 -3.8800 -0.9684 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.9891 -3.3719 -0.1239 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.9824 -4.9955 -1.4661 O 0 0 0 0 0 0 0 0 0 0 0 0

-2.3282 -2.1081 -0.7244 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.1998 -1.5472 0.1667 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.5636 -0.2806 -0.4452 C 0 0 0 0 0 0 0 0 0 0 0 0

0.5636 0.2806 0.4452 C 0 0 0 0 0 0 0 0 0 0 0 0

1.1998 1.5472 -0.1667 C 0 0 0 0 0 0 0 0 0 0 0 0

2.3282 2.1081 0.7244 C 0 0 0 0 0 0 0 0 0 0 0 0

2.9891 3.3719 0.1239 C 0 0 0 0 0 0 0 0 0 0 0 0

4.0459 3.8800 0.9684 C 0 0 0 0 0 0 0 0 0 0 0 0

-5.0253 -3.1856 -1.2147 O 0 0 0 0 0 0 0 0 0 0 0 0

3.9824 4.9955 1.4661 O 0 0 0 0 0 0 0 0 0 0 0 0

5.0253 3.1856 1.2147 O 0 0 0 0 0 0 0 0 0 0 0 0

-3.4067 -3.1372 0.8592 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.2163 -4.1318 0.0295 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.9164 -2.3462 -1.7104 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.0824 -1.3259 -0.8578 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.6046 -1.3045 1.1538 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.4275 -2.3108 0.2979 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.3335 0.4860 -0.5753 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.1574 -0.5196 -1.4327 H 0 0 0 0 0 0 0 0 0 0 0 0

1.3335 -0.4860 0.5753 H 0 0 0 0 0 0 0 0 0 0 0 0

0.1574 0.5196 1.4327 H 0 0 0 0 0 0 0 0 0 0 0 0

1.6046 1.3045 -1.1538 H 0 0 0 0 0 0 0 0 0 0 0 0

0.4275 2.3108 -0.2979 H 0 0 0 0 0 0 0 0 0 0 0 0

1.9164 2.3462 1.7104 H 0 0 0 0 0 0 0 0 0 0 0 0

3.0824 1.3259 0.8578 H 0 0 0 0 0 0 0 0 0 0 0 0

3.4067 3.1372 -0.8592 H 0 0 0 0 0 0 0 0 0 0 0 0

2.2163 4.1318 -0.0295 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.6600 -3.4677 -1.7538 H 0 0 0 0 0 0 0 0 0 0 0 0

5.6600 3.4677 1.7538 H 0 0 0 0 0 0 0 0 0 0 0 0

1 2 1 0 0 0 0

1 3 2 0 0 0 0

2 4 1 0 0 0 0

4 5 1 0 0 0 0

5 6 1 0 0 0 0

6 7 1 0 0 0 0

7 8 1 0 0 0 0

8 9 1 0 0 0 0

9 10 1 0 0 0 0

10 11 1 0 0 0 0

1 12 1 0 0 0 0

13 11 2 0 0 0 0

14 11 1 0 0 0 0

2 15 1 0 0 0 0

2 16 1 0 0 0 0

4 17 1 0 0 0 0

4 18 1 0 0 0 0

5 19 1 0 0 0 0

5 20 1 0 0 0 0

6 21 1 0 0 0 0

6 22 1 0 0 0 0

7 23 1 0 0 0 0

7 24 1 0 0 0 0

8 25 1 0 0 0 0

8 26 1 0 0 0 0

9 27 1 0 0 0 0

9 28 1 0 0 0 0

10 29 1 0 0 0 0

10 30 1 0 0 0 0

12 31 1 0 0 0 0

14 32 1 0 0 0 0

M END): 30 ms

reading 32 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

32 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Wikipedia	License
Sebacic acid is a naturally occurring dicarboxylic acid with the chemical formula HO2C(CH2)8CO2H. It is a white flake or powdered solid. Sebaceus is Latin for tallow candle, sebum is Latin for tallow, and refers to its use in the manufacture of candles. Sebacic acid is a derivative of castor oil. In the industrial setting, sebacic acid and its homologues such as azelaic acid can be used as a monomer for nylon 610, plasticizers, lubricants, hydraulic fluids, cosmetics, candles, etc. It can be used as a surfactant in the lubricating oil industry to increase the antirust properties of lubricating oils on metals.
Read full article at Wikipedia

Formula

C10H18O4

Net Charge

Average Mass

202.24752

Monoisotopic Mass

202.12051

InChI

InChI=1S/C10H18O4/c11-9(12)7-5-3-1-2-4-6-8-10(13)14/h1-8H2,(H,11,12)(H,13,14)

InChIKey

CXMXRPHRNRROMY-UHFFFAOYSA-N

SMILES

OC(=O)CCCCCCCCC(O)=O

Metabolite of Species	Details
Caesalpinia pulcherrima (NCBI:txid53846)	Found in stem (BTO:0001300). See: DOI
Homo sapiens (NCBI:txid9606)	See: PubMed

Roles Classification
Chemical Role(s):	Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Bronsted base). (via oxoacid )

Biological Role(s):	human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms.

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	sebacic acid (CHEBI:41865) has parent hydride decane (CHEBI:41808) sebacic acid (CHEBI:41865) has role human metabolite (CHEBI:77746) sebacic acid (CHEBI:41865) has role plant metabolite (CHEBI:76924) sebacic acid (CHEBI:41865) is a α,ω-dicarboxylic acid (CHEBI:28383) sebacic acid (CHEBI:41865) is a dicarboxylic fatty acid (CHEBI:189840) sebacic acid (CHEBI:41865) is conjugate acid of sebacate (CHEBI:132954) sebacic acid (CHEBI:41865) is conjugate acid of sebacate(2−) (CHEBI:76283)

Incoming	3-hydroxysebacic acid (CHEBI:89182) has functional parent sebacic acid (CHEBI:41865) decanedioyl-CoA (CHEBI:76345) has functional parent sebacic acid (CHEBI:41865) dimethyl sebacate (CHEBI:194205) has functional parent sebacic acid (CHEBI:41865) sebacate (CHEBI:132954) is conjugate base of sebacic acid (CHEBI:41865) sebacate(2−) (CHEBI:76283) is conjugate base of sebacic acid (CHEBI:41865)

IUPAC Name

decanedioic acid

Synonyms	Sources
1,10-decanedioic acid	NIST Chemistry WebBook
1,8-dicarboxyoctane	ChEBI
Decanedioic acid	KEGG COMPOUND
Sebacic acid	KEGG COMPOUND
SEBACIC ACID	PDBeChem
Sebacinsäure	ChEBI

Manual Xrefs	Databases
C00001202	KNApSAcK
C08277	KEGG COMPOUND
CPD-3623	MetaCyc
DB07645	DrugBank
DEC	PDBeChem
HMDB0000792	HMDB
LMFA01170006	LIPID MAPS
Sebacic_acid	Wikipedia
View more database links

Registry Numbers	Types	Sources
102423	Gmelin Registry Number	Gmelin
111-20-6	CAS Registry Number	NIST Chemistry WebBook
111-20-6	CAS Registry Number	ChemIDplus
1210591	Beilstein Registry Number	ChemIDplus
1210591	Reaxys Registry Number	Reaxys

Citations

Roux A, Xu Y, Heilier JF, Olivier MF, Ezan E, Tabet JC, Junot C (2012)
Annotation of the human adult urinary metabolome and metabolite identification using ultra high performance liquid chromatography coupled to a linear quadrupole ion trap-Orbitrap mass spectrometer.
Analytical chemistry 84, 6429-6437 [PubMed:22770225]
[show Abstract]

Suh JW, Lee SH, Chung BC (1997)
GC-MS determination of organic acids with solvent extraction after cation-exchange chromatography.
Clinical chemistry 43, 2256-2261 [PubMed:9439441]
[show Abstract]

Last Modified

10 January 2023

CHEBI:41865 - sebacic acid

ChEBI is part of the ELIXIR infrastructure