zanamivir (CHEBI:50663)

ChEBI > Main

CHEBI:50663 - zanamivir

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	zanamivir

ChEBI ID	CHEBI:50663

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:46607, CHEBI:10104

Supplier Information	ChemicalBook:CB0292498, eMolecules:31590542, Selleckchem:zanamivir-relenza, ZINC000003918138

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__635959424056318__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__635959424056318__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:50663","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__635959424056318__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"635959424056318","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__635959424056318__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 09190812203D

starting HoverWatcher_5

Time for openFile(

Marvin 09190812203D

43 43 0 0 0 0 999 V2000

-3.4497 -0.2038 -1.3370 C 0 0 0 0 0 0 0 0 0 0 0 0

-4.1429 0.9502 -1.2733 O 0 0 0 0 0 0 0 0 0 0 0 0

-3.9743 -1.2041 -1.7836 O 0 0 0 0 0 0 0 0 0 0 0 0

-2.0547 -0.2518 -0.8634 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.4372 -1.4123 -0.9539 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.0039 -1.5978 -0.5241 C 0 0 1 0 0 0 0 0 0 0 0 0

0.4222 -0.3519 0.2644 C 0 0 1 0 0 0 0 0 0 0 0 0

1.8842 -0.2846 0.3371 N 0 0 0 0 0 0 0 0 0 0 0 0

2.5354 -0.8563 1.3686 C 0 0 0 0 0 0 0 0 0 0 0 0

1.9116 -1.4271 2.2378 O 0 0 0 0 0 0 0 0 0 0 0 0

4.0389 -0.7864 1.4431 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.1203 0.8726 -0.4805 C 0 0 1 0 0 0 0 0 0 0 0 0

-1.5387 0.8926 -0.3815 O 0 0 0 0 0 0 0 0 0 0 0 0

0.4531 2.1486 0.1394 C 0 0 2 0 0 0 0 0 0 0 0 0

0.0741 2.2200 1.5152 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.0942 3.3680 -0.6031 C 0 0 2 0 0 0 0 0 0 0 0 0

0.2849 3.2966 -1.9790 O 0 0 0 0 0 0 0 0 0 0 0 0

0.4792 4.6439 0.0167 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.0321 5.7828 -0.6774 O 0 0 0 0 0 0 0 0 0 0 0 0

0.1093 -2.7859 0.3256 N 0 0 0 0 0 0 0 0 0 0 0 0

0.9836 -3.7093 0.0432 C 0 0 0 0 0 0 0 0 0 0 0 0

0.9886 -4.8905 0.7462 N 0 0 0 0 0 0 0 0 0 0 0 0

1.9020 -3.5017 -0.9578 N 0 0 0 0 0 0 0 0 0 0 0 0

-5.0581 0.9824 -1.5837 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.9757 -2.2605 -1.3514 H 0 0 0 0 0 0 0 0 0 0 0 0

0.6315 -1.7124 -1.4026 H 0 0 0 0 0 0 0 0 0 0 0 0

0.0040 -0.3898 1.2699 H 0 0 0 0 0 0 0 0 0 0 0 0

2.3825 0.1714 -0.3588 H 0 0 0 0 0 0 0 0 0 0 0 0

4.3826 -1.3004 2.3399 H 0 0 0 0 0 0 0 0 0 0 0 0

4.4678 -1.2648 0.5634 H 0 0 0 0 0 0 0 0 0 0 0 0

4.3524 0.2568 1.4791 H 0 0 0 0 0 0 0 0 0 0 0 0

0.1698 0.8174 -1.5290 H 0 0 0 0 0 0 0 0 0 0 0 0

1.5391 2.1329 0.0639 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.8931 2.2321 1.5393 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.1805 3.3837 -0.5267 H 0 0 0 0 0 0 0 0 0 0 0 0

1.2518 3.2854 -2.0033 H 0 0 0 0 0 0 0 0 0 0 0 0

0.1903 4.6987 1.0657 H 0 0 0 0 0 0 0 0 0 0 0 0

1.5656 4.6281 -0.0596 H 0 0 0 0 0 0 0 0 0 0 0 0

0.3535 6.5634 -0.2562 H 0 0 0 0 0 0 0 0 0 0 0 0

1.6393 -5.5773 0.5367 H 0 0 0 0 0 0 0 0 0 0 0 0

0.3406 -5.0369 1.4528 H 0 0 0 0 0 0 0 0 0 0 0 0

2.4422 -4.2405 -1.2814 H 0 0 0 0 0 0 0 0 0 0 0 0

2.0096 -2.6178 -1.3420 H 0 0 0 0 0 0 0 0 0 0 0 0

1 2 1 0 0 0 0

1 3 2 0 0 0 0

1 4 1 0 0 0 0

2 24 1 0 0 0 0

4 5 2 0 0 0 0

4 13 1 0 0 0 0

5 6 1 0 0 0 0

5 25 1 0 0 0 0

6 7 1 0 0 0 0

6 20 1 0 0 0 0

6 26 1 0 0 0 0

7 8 1 0 0 0 0

7 12 1 0 0 0 0

7 27 1 0 0 0 0

8 9 1 0 0 0 0

8 28 1 0 0 0 0

9 10 2 0 0 0 0

9 11 1 0 0 0 0

11 29 1 0 0 0 0

11 30 1 0 0 0 0

11 31 1 0 0 0 0

12 13 1 0 0 0 0

12 14 1 0 0 0 0

12 32 1 0 0 0 0

14 15 1 0 0 0 0

14 16 1 0 0 0 0

14 33 1 0 0 0 0

15 34 1 0 0 0 0

16 17 1 0 0 0 0

16 18 1 0 0 0 0

16 35 1 0 0 0 0

17 36 1 0 0 0 0

18 19 1 0 0 0 0

18 37 1 0 0 0 0

18 38 1 0 0 0 0

19 39 1 0 0 0 0

20 21 2 0 0 0 0

21 22 1 0 0 0 0

21 23 1 0 0 0 0

22 40 1 0 0 0 0

22 41 1 0 0 0 0

23 42 1 0 0 0 0

23 43 1 0 0 0 0

M END): 25 ms

reading 43 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

43 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Wikipedia	License
Zanamivir, sold under the brand name Relenza among others, is an anti-viral medication used to treat and prevent influenza caused by influenza A and influenza B viruses. It is a neuraminidase inhibitor and was developed by the Australian biotech firm Biota Holdings. It was licensed to Glaxo Wellcome in 1990 and approved in the US in 1999, only for use as a treatment for influenza. In 2006, it was approved for prevention of influenza A and B. Zanamivir is the first neuraminidase inhibitor commercially developed. It was developed by GlaxoSmithKline.
Read full article at Wikipedia

Formula

C12H20N4O7

Net Charge

Average Mass

332.30996

Monoisotopic Mass

332.13320

InChI

InChI=1S/C12H20N4O7/c1-4(18)15-8-5(16-12(13)14)2-7(11(21)22)23-10(8)9(20)6(19)3-17/h2,5-6,8-10,17,19-20H,3H2,1H3,(H,15,18)(H,21,22)(H4,13,14,16)/t5-,6+,8+,9+,10+/m0/s1

InChIKey

ARAIBEBZBOPLMB-UFGQHTETSA-N

SMILES

[H][C@]1(OC(=C[C@H](NC(N)=N)[C@H]1NC(C)=O)C(O)=O)[C@H](O)[C@H](O)CO

Roles Classification
Biological Role(s):	EC 3.2.1.18 (exo-alpha-sialidase) inhibitor An antiviral drug targeted at influenza viruses. Its mode of action consists of blocking the function of the viral neuraminidase protein (EC 3.2.1.18), thus preventing the virus from budding from the host cell. antiviral agent A substance that destroys or inhibits replication of viruses.

Application(s):	EC 3.2.1.18 (exo-alpha-sialidase) inhibitor An antiviral drug targeted at influenza viruses. Its mode of action consists of blocking the function of the viral neuraminidase protein (EC 3.2.1.18), thus preventing the virus from budding from the host cell.

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	zanamivir (CHEBI:50663) has role antiviral agent (CHEBI:22587) zanamivir (CHEBI:50663) has role EC 3.2.1.18 (exo-α-sialidase) inhibitor (CHEBI:52425) zanamivir (CHEBI:50663) is a guanidines (CHEBI:24436)

IUPAC Name

5-acetamido-2,6-anhydro-4-carbamimidamido-3,4,5-trideoxy-D-glycero-D-galacto-non-2-enonic acid

INN	Source
zanamivir	KEGG DRUG

Synonyms	Sources
(2R,3R,4S)-3-(acetylamino)-4-carbamimidamido-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid	IUPAC
4-guanidino-2,4-dideoxy-2,3-dehydro-N-acetylneuraminic acid	ChemIDplus
4-guanidino-Neu5Ac2en	ChemIDplus
5-(acetylamino)-2,6-anhydro-4-carbamimidamido-3,4,5-trideoxy-D-glycero-D-galacto-non-2-enonic acid	IUPAC
5-acetamido-2,6-anhydro-3,4,5-trideoxy-4-guanidino-D-glycero-D-galacto-non-2-enonic acid	ChemIDplus
GANA	ChemIDplus
ZANAMIVIR	PDBeChem

Brand Name	Source
Relenza	KEGG DRUG

Manual Xrefs	Databases
2859	DrugCentral
C08095	KEGG COMPOUND
D00902	KEGG DRUG
DB00558	DrugBank
US5360817	Patent
WO9116320	Patent
Zanamivir	Wikipedia
ZMR	PDBeChem
View more database links

Registry Numbers	Types	Sources
139110-80-8	CAS Registry Number	KEGG COMPOUND
139110-80-8	CAS Registry Number	ChemIDplus
7083099	Beilstein Registry Number	Beilstein

Last Modified

22 February 2017

CHEBI:50663 - zanamivir

ChEBI is part of the ELIXIR infrastructure