montelukast (CHEBI:50730)

ChEBI > Main

CHEBI:50730 - montelukast

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	montelukast

ChEBI ID	CHEBI:50730

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:49756, CHEBI:6992

Supplier Information	ChemicalBook:CB7112818, ZINC000003831151

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__6465925111240427__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__6465925111240427__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:50730","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__6465925111240427__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"6465925111240427","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__6465925111240427__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 05160814363D

starting HoverWatcher_5

Time for openFile(

Marvin 05160814363D

79 83 0 0 0 0 999 V2000

-6.1520 2.5180 7.7910 C 0 0 0 0 0 0 0 0 0 0 0 0

-7.1270 1.5350 7.7090 C 0 0 0 0 0 0 0 0 0 0 0 0

-7.8350 1.3410 6.5150 C 0 0 0 0 0 0 0 0 0 0 0 0

-8.8280 0.3540 6.3990 C 0 0 0 0 0 0 0 0 0 0 0 0

-9.5160 0.1840 5.2010 C 0 0 0 0 0 0 0 0 0 0 0 0

-9.2150 0.9970 4.1160 C 0 0 0 0 0 0 0 0 0 0 0 0

-10.0600 0.7970 2.6300 Cl 0 0 0 0 0 0 0 0 0 0 0 0

-8.2270 1.9790 4.2310 C 0 0 0 0 0 0 0 0 0 0 0 0

-7.5240 2.1710 5.4170 C 0 0 0 0 0 0 0 0 0 0 0 0

-6.5780 3.1260 5.4930 N 0 0 0 0 0 0 0 0 0 0 0 0

-5.9180 3.2800 6.6640 C 0 0 0 0 0 0 0 0 0 0 0 0

-4.8800 4.3510 6.7070 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.4710 3.8760 6.2980 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.4040 3.3640 4.8800 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.1120 4.2460 3.8520 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.6370 2.0200 4.6320 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.5750 1.5460 3.3220 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.2820 2.4220 2.2760 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.0500 3.7720 2.5410 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.7380 4.7080 1.4230 C 0 0 2 0 0 0 0 0 0 0 0 0

-4.1860 4.8700 0.2880 S 0 0 0 0 0 0 0 0 0 0 0 0

-5.3590 5.5060 1.5010 C 0 0 0 0 0 0 0 0 0 0 0 0

-6.7090 5.7550 0.8560 C 0 0 1 0 0 0 0 0 0 0 0 0

-7.3930 4.5820 0.2490 C 0 0 0 0 0 0 0 0 0 0 0 0

-7.8980 5.1710 1.5340 C 0 0 0 0 0 0 0 0 0 0 0 0

-6.8190 7.0770 0.2060 C 0 0 0 0 0 0 0 0 0 0 0 0

-6.2710 7.1020 -1.2150 C 0 0 0 0 0 0 0 0 0 0 0 0

-5.7240 8.3070 -1.5170 O 0 0 0 0 0 0 0 0 0 0 0 0

-6.3150 6.1610 -1.9940 O 0 0 0 0 0 0 0 0 0 0 0 0

-1.4810 4.3700 0.5700 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.1540 4.4620 1.3470 C 0 0 0 0 0 0 0 0 0 0 0 0

1.0930 4.2740 0.5220 C 0 0 0 0 0 0 0 0 0 0 0 0

1.1880 4.9330 -0.6970 C 0 0 0 0 0 0 0 0 0 0 0 0

2.3330 4.7720 -1.4770 C 0 0 0 0 0 0 0 0 0 0 0 0

3.3720 3.9550 -1.0310 C 0 0 0 0 0 0 0 0 0 0 0 0

3.2660 3.2980 0.1950 C 0 0 0 0 0 0 0 0 0 0 0 0

2.1210 3.4590 0.9750 C 0 0 0 0 0 0 0 0 0 0 0 0

2.0300 2.7460 2.2840 C 0 0 2 0 0 0 0 0 0 0 0 0

1.8660 3.6690 3.5180 C 0 0 0 0 0 0 0 0 0 0 0 0

3.2620 1.8390 2.4980 C 0 0 0 0 0 0 0 0 0 0 0 0

0.8690 1.8850 2.3090 O 0 0 0 0 0 0 0 0 0 0 0 0

-5.6000 2.6740 8.7110 H 0 0 0 0 0 0 0 0 0 0 0 0

-7.3310 0.9180 8.5810 H 0 0 0 0 0 0 0 0 0 0 0 0

-9.0720 -0.2880 7.2430 H 0 0 0 0 0 0 0 0 0 0 0 0

-10.2820 -0.5840 5.1320 H 0 0 0 0 0 0 0 0 0 0 0 0

-8.0000 2.6110 3.3740 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.1780 5.1690 6.0290 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.8380 4.8140 7.7070 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.1450 3.0710 6.9700 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.7450 4.6880 6.4360 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.9320 5.2980 4.0580 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.8660 1.3310 5.4400 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.7540 0.4950 3.1150 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.2360 2.0440 1.2580 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.5850 5.7300 1.8140 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.4550 4.7790 2.3130 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.9620 6.4350 1.9210 H 0 0 0 0 0 0 0 0 0 0 0 0

-6.8920 3.6220 0.2990 H 0 0 0 0 0 0 0 0 0 0 0 0

-8.0010 4.7170 -0.6380 H 0 0 0 0 0 0 0 0 0 0 0 0

-8.8430 5.6990 1.5070 H 0 0 0 0 0 0 0 0 0 0 0 0

-7.7330 4.6050 2.4430 H 0 0 0 0 0 0 0 0 0 0 0 0

-7.8750 7.4120 0.1450 H 0 0 0 0 0 0 0 0 0 0 0 0

-6.2640 7.8530 0.7730 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.3690 8.3290 -2.4310 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.5800 3.3860 0.0970 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.3970 5.0950 -0.2510 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.0910 5.4540 1.8130 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.1710 3.7470 2.1790 H 0 0 0 0 0 0 0 0 0 0 0 0

0.3830 5.5700 -1.0530 H 0 0 0 0 0 0 0 0 0 0 0 0

2.4140 5.2820 -2.4330 H 0 0 0 0 0 0 0 0 0 0 0 0

4.2630 3.8300 -1.6390 H 0 0 0 0 0 0 0 0 0 0 0 0

4.0800 2.6630 0.5330 H 0 0 0 0 0 0 0 0 0 0 0 0

1.6710 3.0980 4.4330 H 0 0 0 0 0 0 0 0 0 0 0 0

2.7550 4.2820 3.6950 H 0 0 0 0 0 0 0 0 0 0 0 0

1.0070 4.3360 3.3800 H 0 0 0 0 0 0 0 0 0 0 0 0

3.1990 1.2720 3.4350 H 0 0 0 0 0 0 0 0 0 0 0 0

4.1880 2.4230 2.5110 H 0 0 0 0 0 0 0 0 0 0 0 0

3.3380 1.0970 1.6940 H 0 0 0 0 0 0 0 0 0 0 0 0

1.1060 1.1190 1.7730 H 0 0 0 0 0 0 0 0 0 0 0 0

1 2 4 0 0 0 0

1 11 4 0 0 0 0

1 42 1 0 0 0 0

2 3 4 0 0 0 0

2 43 1 0 0 0 0

3 4 4 0 0 0 0

3 9 4 0 0 0 0

4 5 4 0 0 0 0

4 44 1 0 0 0 0

5 6 4 0 0 0 0

5 45 1 0 0 0 0

6 7 1 0 0 0 0

6 8 4 0 0 0 0

8 9 4 0 0 0 0

8 46 1 0 0 0 0

9 10 4 0 0 0 0

10 11 4 0 0 0 0

11 12 1 0 0 0 0

12 13 1 0 0 0 0

12 47 1 0 0 0 0

12 48 1 0 0 0 0

13 14 1 0 0 0 0

13 49 1 0 0 0 0

13 50 1 0 0 0 0

14 15 4 0 0 0 0

14 16 4 0 0 0 0

15 19 4 0 0 0 0

15 51 1 0 0 0 0

16 17 4 0 0 0 0

16 52 1 0 0 0 0

17 18 4 0 0 0 0

17 53 1 0 0 0 0

18 19 4 0 0 0 0

18 54 1 0 0 0 0

19 20 1 0 0 0 0

20 21 1 0 0 0 0

20 30 1 0 0 0 0

20 55 1 0 0 0 0

21 22 1 0 0 0 0

22 23 1 0 0 0 0

22 56 1 0 0 0 0

22 57 1 0 0 0 0

23 24 1 0 0 0 0

23 25 1 0 0 0 0

23 26 1 0 0 0 0

24 25 1 0 0 0 0

24 58 1 0 0 0 0

24 59 1 0 0 0 0

25 60 1 0 0 0 0

25 61 1 0 0 0 0

26 27 1 0 0 0 0

26 62 1 0 0 0 0

26 63 1 0 0 0 0

27 28 1 0 0 0 0

27 29 2 0 0 0 0

28 64 1 0 0 0 0

30 31 1 0 0 0 0

30 65 1 0 0 0 0

30 66 1 0 0 0 0

31 32 1 0 0 0 0

31 67 1 0 0 0 0

31 68 1 0 0 0 0

32 33 4 0 0 0 0

32 37 4 0 0 0 0

33 34 4 0 0 0 0

33 69 1 0 0 0 0

34 35 4 0 0 0 0

34 70 1 0 0 0 0

35 36 4 0 0 0 0

35 71 1 0 0 0 0

36 37 4 0 0 0 0

36 72 1 0 0 0 0

37 38 1 0 0 0 0

38 39 1 0 0 0 0

38 40 1 0 0 0 0

38 41 1 0 0 0 0

39 73 1 0 0 0 0

39 74 1 0 0 0 0

39 75 1 0 0 0 0

40 76 1 0 0 0 0

40 77 1 0 0 0 0

40 78 1 0 0 0 0

41 79 1 0 0 0 0

M END): 19 ms

reading 79 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

79 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Wikipedia	License
Montelukast, sold under the brand name Singulair among others, is a medication used in the maintenance treatment of asthma. It is generally less preferred for this use than inhaled corticosteroids. It is not useful for acute asthma attacks. Other uses include allergic rhinitis and hives of long duration. For allergic rhinitis it is a second-line treatment. Common side effects include abdominal pain, cough, and headache. Severe side effects may include allergic reactions, such as anaphylaxis and eosinophilia. Use in pregnancy appears to be safe. Montelukast is in the leukotriene receptor antagonist family of medications. It works by blocking the action of leukotriene D4 in the lungs resulting in decreased inflammation and relaxation of smooth muscle. Montelukast was approved for medical use in the United States in 1998. It is available as a generic medication. In 2022, it was the seventeenth most commonly prescribed medication in the United States, with more than 29 million prescriptions.
Read full article at Wikipedia

Formula

C35H36ClNO3S

Net Charge

Average Mass

586.18398

Monoisotopic Mass

585.21044

InChI

InChI=1S/C35H36ClNO3S/c1-34(2,40)30-9-4-3-7-25(30)13-17-32(41-23-35(18-19-35)22-33(38)39)27-8-5-6-24(20-27)10-15-29-16-12-26-11-14-28(36)21-31(26)37-29/h3-12,14-16,20-21,32,40H,13,17-19,22-23H2,1-2H3,(H,38,39)/b15-10+/t32-/m1/s1

InChIKey

UCHDWCPVSPXUMX-TZIWLTJVSA-N

SMILES

CC(C)(O)c1ccccc1CC[C@@H](SCC1(CC1)CC(O)=O)c1cccc(\C=C\c2ccc3ccc(Cl)cc3n2)c1

Roles Classification
Chemical Role(s):	Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Bronsted base). (via oxoacid )

Biological Role(s):	leukotriene antagonist A drug designed to prevent leukotriene synthesis or activity by blocking binding at the receptor level.

Application(s):	anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. anti-asthmatic drug A drug used to treat asthma. leukotriene antagonist A drug designed to prevent leukotriene synthesis or activity by blocking binding at the receptor level.

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	montelukast (CHEBI:50730) has role anti-arrhythmia drug (CHEBI:38070) montelukast (CHEBI:50730) has role anti-asthmatic drug (CHEBI:49167) montelukast (CHEBI:50730) has role leukotriene antagonist (CHEBI:49159) montelukast (CHEBI:50730) is a aliphatic sulfide (CHEBI:22327) montelukast (CHEBI:50730) is a monocarboxylic acid (CHEBI:25384) montelukast (CHEBI:50730) is a quinolines (CHEBI:26513) montelukast (CHEBI:50730) is conjugate acid of montelukast(1−) (CHEBI:49165)

Incoming	montelukast nitrile (CHEBI:48970) has functional parent montelukast (CHEBI:50730) montelukast(1−) (CHEBI:49165) is conjugate base of montelukast (CHEBI:50730)

IUPAC Name

{1-[({(1R)-1-{3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl}-3-[2-(2-hydroxypropan-2-yl)phenyl]propyl}sulfanyl)methyl]cyclopropyl}acetic acid

INN	Source
montelukast	ChEBI

Synonyms	Sources
(R-(E))-1-(((1-(3-(2-(7-Chloro-2-quinolinyl)ethenyl)phenyl)-3-(2-(1-hydroxy-1-methylethyl)phenyl)propyl)thio)methyl)cyclopropaneacetic acid	ChemIDplus
1-[[[(1 R)-1-[3-[(1E)-2-(7-chloro-2-quinolinyl)ethenyl] phenyl]-3-[2-(1-hydroxy-1-methylethyl)phenyl]propyl]sulfanyl]methyl]cyclopropaneacetic acid	Patent
Montelukast	KEGG COMPOUND
MONTELUKAST	PDBeChem

Manual Xrefs	Databases
1836	DrugCentral
C07482	KEGG COMPOUND
D08229	KEGG DRUG
DB00471	DrugBank
EP1886997	Patent
Montelukast	Wikipedia
MTK	PDBeChem
View more database links

Registry Numbers	Types	Sources
158966-92-8	CAS Registry Number	KEGG COMPOUND
158966-92-8	CAS Registry Number	ChemIDplus
7896575	Beilstein Registry Number	Beilstein

Last Modified

22 February 2017

CHEBI:50730 - montelukast

ChEBI is part of the ELIXIR infrastructure