mitoxantrone (CHEBI:50729)

ChEBI > Main

CHEBI:50729 - mitoxantrone

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	mitoxantrone

ChEBI ID	CHEBI:50729

Definition	A dihydroxyanthraquinone that is 1,4-dihydroxy-9,10-anthraquinone which is substituted by 6-hydroxy-1,4-diazahexyl groups at positions 5 and 8.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:43919, CHEBI:6955

Supplier Information	ChemicalBook:CB1246423, eMolecules:742146, ZINC000003794794

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__720421132498161__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__720421132498161__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:6955","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__720421132498161__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"720421132498161","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__720421132498161__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 09130719353D

starting HoverWatcher_5

Time for openFile(

Marvin 09130719353D

60 62 0 0 0 0 999 V2000

7.7880 4.6150 0.7750 O 0 0 0 0 0 0 0 0 0 0 0 0

7.9870 3.8240 -0.3990 C 0 0 0 0 0 0 0 0 0 0 0 0

7.1690 2.5360 -0.2900 C 0 0 0 0 0 0 0 0 0 0 0 0

5.7370 2.8640 -0.2810 N 0 0 0 0 0 0 0 0 0 0 0 0

5.0130 1.5900 -0.1750 C 0 0 0 0 0 0 0 0 0 0 0 0

3.5070 1.8590 -0.1600 C 0 0 0 0 0 0 0 0 0 0 0 0

2.7850 0.5890 -0.0550 N 0 0 0 0 0 0 0 0 0 0 0 0

1.3980 0.5800 -0.0230 C 0 0 0 0 0 0 0 0 0 0 0 0

0.6870 1.7790 -0.1220 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.6870 1.7800 -0.0910 C 0 0 0 0 0 0 0 0 0 0 0 0

0.7070 -0.6280 0.1030 C 0 0 0 0 0 0 0 0 0 0 0 0

1.4380 -1.9030 0.2160 C 0 0 0 0 0 0 0 0 0 0 0 0

2.6340 -1.9100 0.4400 O 0 0 0 0 0 0 0 0 0 0 0 0

0.7030 -3.1700 0.0480 C 0 0 0 0 0 0 0 0 0 0 0 0

1.3890 -4.3710 -0.1390 C 0 0 0 0 0 0 0 0 0 0 0 0

2.7450 -4.3830 -0.1670 O 0 0 0 0 0 0 0 0 0 0 0 0

0.6760 -5.5580 -0.2980 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.7010 -5.5560 -0.2710 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.4030 -4.3670 -0.0840 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.7590 -4.3750 -0.0590 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.7070 -3.1680 0.0770 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.4320 -1.8990 0.2760 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.6170 -1.9040 0.5510 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.7040 -0.6260 0.1390 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.3960 0.5830 0.0390 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.7830 0.5950 0.0690 N 0 0 0 0 0 0 0 0 0 0 0 0

-3.5040 1.8700 0.1100 C 0 0 0 0 0 0 0 0 0 0 0 0

-5.0110 1.6040 0.1370 C 0 0 0 0 0 0 0 0 0 0 0 0

-5.7330 2.8820 0.1780 N 0 0 0 0 0 0 0 0 0 0 0 0

-7.1650 2.5570 0.2020 C 0 0 0 0 0 0 0 0 0 0 0 0

-7.9820 3.8500 0.2450 C 0 0 0 0 0 0 0 0 0 0 0 0

-7.7800 4.5810 -0.9660 O 0 0 0 0 0 0 0 0 0 0 0 0

8.3190 5.4160 0.6660 H 0 0 0 0 0 0 0 0 0 0 0 0

7.6640 4.3870 -1.2750 H 0 0 0 0 0 0 0 0 0 0 0 0

9.0440 3.5770 -0.4950 H 0 0 0 0 0 0 0 0 0 0 0 0

7.3890 1.8930 -1.1420 H 0 0 0 0 0 0 0 0 0 0 0 0

7.4290 2.0170 0.6330 H 0 0 0 0 0 0 0 0 0 0 0 0

5.5610 3.3690 0.5750 H 0 0 0 0 0 0 0 0 0 0 0 0

5.2610 0.9590 -1.0290 H 0 0 0 0 0 0 0 0 0 0 0 0

5.3010 1.0840 0.7460 H 0 0 0 0 0 0 0 0 0 0 0 0

3.2590 2.4900 0.6940 H 0 0 0 0 0 0 0 0 0 0 0 0

3.2190 2.3650 -1.0810 H 0 0 0 0 0 0 0 0 0 0 0 0

3.2760 -0.2460 -0.0070 H 0 0 0 0 0 0 0 0 0 0 0 0

1.2210 2.7120 -0.2240 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.2240 2.7150 -0.1680 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.2760 -0.2400 0.0630 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.2170 2.4220 1.0050 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.2550 2.4570 -0.7740 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.2980 1.0520 -0.7580 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.2600 1.0170 1.0210 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.5180 3.3090 1.0670 H 0 0 0 0 0 0 0 0 0 0 0 0

-7.4250 1.9930 -0.6940 H 0 0 0 0 0 0 0 0 0 0 0 0

-7.3870 1.9580 1.0850 H 0 0 0 0 0 0 0 0 0 0 0 0

-9.0390 3.6090 0.3530 H 0 0 0 0 0 0 0 0 0 0 0 0

-7.6590 4.4550 1.0930 H 0 0 0 0 0 0 0 0 0 0 0 0

-8.3110 5.3870 -0.8980 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.0570 -4.2430 -0.9700 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.2400 -6.4830 -0.3960 H 0 0 0 0 0 0 0 0 0 0 0 0

1.2080 -6.4860 -0.4430 H 0 0 0 0 0 0 0 0 0 0 0 0

3.0070 -4.2520 -1.0880 H 0 0 0 0 0 0 0 0 0 0 0 0

1 2 1 0 0 0 0

1 33 1 0 0 0 0

2 3 1 0 0 0 0

2 34 1 0 0 0 0

2 35 1 0 0 0 0

3 4 1 0 0 0 0

3 36 1 0 0 0 0

3 37 1 0 0 0 0

4 5 1 0 0 0 0

4 38 1 0 0 0 0

5 6 1 0 0 0 0

5 39 1 0 0 0 0

5 40 1 0 0 0 0

6 7 1 0 0 0 0

6 41 1 0 0 0 0

6 42 1 0 0 0 0

7 8 1 0 0 0 0

7 43 1 0 0 0 0

8 9 4 0 0 0 0

8 11 4 0 0 0 0

9 10 4 0 0 0 0

9 44 1 0 0 0 0

10 25 4 0 0 0 0

10 45 1 0 0 0 0

11 12 1 0 0 0 0

11 24 4 0 0 0 0

12 13 2 0 0 0 0

12 14 1 0 0 0 0

14 15 4 0 0 0 0

14 21 4 0 0 0 0

15 16 1 0 0 0 0

15 17 4 0 0 0 0

16 60 1 0 0 0 0

17 18 4 0 0 0 0

17 59 1 0 0 0 0

18 19 4 0 0 0 0

18 58 1 0 0 0 0

19 20 1 0 0 0 0

19 21 4 0 0 0 0

20 57 1 0 0 0 0

21 22 1 0 0 0 0

22 23 2 0 0 0 0

22 24 1 0 0 0 0

24 25 4 0 0 0 0

25 26 1 0 0 0 0

26 27 1 0 0 0 0

26 46 1 0 0 0 0

27 28 1 0 0 0 0

27 47 1 0 0 0 0

27 48 1 0 0 0 0

28 29 1 0 0 0 0

28 49 1 0 0 0 0

28 50 1 0 0 0 0

29 30 1 0 0 0 0

29 51 1 0 0 0 0

30 31 1 0 0 0 0

30 52 1 0 0 0 0

30 53 1 0 0 0 0

31 32 1 0 0 0 0

31 54 1 0 0 0 0

31 55 1 0 0 0 0

32 56 1 0 0 0 0

M END): 18 ms

reading 60 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

60 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Wikipedia	License
Mitoxantrone (INN, BAN, USAN; also known as Mitozantrone in Australia; trade name Novantrone) is an anthracenedione antineoplastic agent.
Read full article at Wikipedia

Formula

C22H28N4O6

Net Charge

Average Mass

444.48108

Monoisotopic Mass

444.20088

InChI

InChI=1S/C22H28N4O6/c27-11-9-23-5-7-25-13-1-2-14(26-8-6-24-10-12-28)18-17(13)21(31)19-15(29)3-4-16(30)20(19)22(18)32/h1-4,23-30H,5-12H2

InChIKey

KKZJGLLVHKMTCM-UHFFFAOYSA-N

SMILES

OCCNCCNc1ccc(NCCNCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12

Roles Classification
Biological Role(s):	analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms.

Application(s):	analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms.

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	mitoxantrone (CHEBI:50729) has role analgesic (CHEBI:35480) mitoxantrone (CHEBI:50729) has role antineoplastic agent (CHEBI:35610) mitoxantrone (CHEBI:50729) is a dihydroxyanthraquinone (CHEBI:37484)

Incoming	mitoxantrone dihydrochloride (CHEBI:50727) has part mitoxantrone (CHEBI:50729)

IUPAC Name

1,4-dihydroxy-5,8-bis({2-[(2-hydroxyethyl)amino]ethyl}amino)anthracene-9,10-dione

INNs	Sources
mitoxantrona	ChemIDplus
mitoxantrone	ChemIDplus
mitoxantronum	ChemIDplus

Synonyms	Sources
1,4-DIHYDROXY-5,8-BIS({2-[(2-HYDROXYETHYL)AMINO]ETHYL}AMINO)-9,10-ANTHRACENEDIONE	PDBeChem
Mitoxantrone	KEGG COMPOUND

Manual Xrefs	Databases
1821	DrugCentral
C11195	KEGG COMPOUND
D08224	KEGG DRUG
DB01204	DrugBank
DE2835661	Patent
LSM-2481	LINCS
Mitoxantrone	Wikipedia
MIX	PDBeChem
US4197249	Patent
View more database links

Registry Numbers	Types	Sources
2795126	Beilstein Registry Number	Beilstein
65271-80-9	CAS Registry Number	KEGG COMPOUND
65271-80-9	CAS Registry Number	ChemIDplus

Last Modified

22 February 2017

CHEBI:50729 - mitoxantrone

ChEBI is part of the ELIXIR infrastructure